C22H18FNO4 — CID 1025841
ethyl (1S)-3-amino-1-(4-fluorophenyl)-9-hydroxy-1H-benzo[f]chromene-2-carboxylate (PubChem CID 1025841) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is ethyl (1S)-3-amino-1-(4-fluorophenyl)-9-hydroxy-1H-benzo[f]chromene-2-carboxylate.
| Compound Name | ethyl (1S)-3-amino-1-(4-fluorophenyl)-9-hydroxy-1H-benzo[f]chromene-2-carboxylate |
|---|---|
| PubChem CID | 1025841 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | ethyl (1S)-3-amino-1-(4-fluorophenyl)-9-hydroxy-1H-benzo[f]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2ccc3ccc(O)cc3c2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FNO4/c1-2-27-22(26)20-18(13-3-7-14(23)8-4-13)19-16-11-15(25)9-5-12(16)6-10-17(19)28-21(20)24/h3-11,18,25H,2,24H2,1H3/t18-/m0/s1 |
| InChIKey | OYIOAABPCKBXJT-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |