C25H25Cl2N2O3+ — CID 52937297
2-[3-amino-1-(2,4-dichlorophenyl)-1H-benzo[f]chromene-2-carbonyl]oxyethyl-trimethylazanium (PubChem CID 52937297) has the molecular formula C25H25Cl2N2O3+ and a molecular weight of 472.39 g/mol. Its IUPAC name is 2-[3-amino-1-(2,4-dichlorophenyl)-1H-benzo[f]chromene-2-carbonyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[3-amino-1-(2,4-dichlorophenyl)-1H-benzo[f]chromene-2-carbonyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 52937297 |
| Molecular Formula | C25H25Cl2N2O3+ |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-[3-amino-1-(2,4-dichlorophenyl)-1H-benzo[f]chromene-2-carbonyl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)C1=C(N)Oc2ccc3ccccc3c2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-29(2,3)12-13-31-25(30)23-22(18-10-9-16(26)14-19(18)27)21-17-7-5-4-6-15(17)8-11-20(21)32-24(23)28/h4-11,14,22H,12-13H2,1-3H3,(H-,28,30)/p+1 |
| InChIKey | RTMAXPIVFDNAPV-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|