C28H23NO6 — CID 146163793
ethyl 2-hydroxy-3-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1,3-dihydropyrrole-4-carboxylate (PubChem CID 146163793) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is ethyl 2-hydroxy-3-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1,3-dihydropyrrole-4-carboxylate.
| Compound Name | ethyl 2-hydroxy-3-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1,3-dihydropyrrole-4-carboxylate |
|---|---|
| PubChem CID | 146163793 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | ethyl 2-hydroxy-3-(4-hydroxy-2-oxochromen-3-yl)-2,5-diphenyl-1,3-dihydropyrrole-4-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC(O)(c2ccccc2)C1c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C28H23NO6/c1-2-34-26(31)21-23(22-25(30)19-15-9-10-16-20(19)35-27(22)32)28(33,18-13-7-4-8-14-18)29-24(21)17-11-5-3-6-12-17/h3-16,23,29-30,33H,2H2,1H3 |
| InChIKey | QCYJVZJOGONTSK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|