C20H17NO5S — CID 1284275
ethyl (4R)-2-amino-4-(3-methylthiophen-2-yl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate (PubChem CID 1284275) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is ethyl (4R)-2-amino-4-(3-methylthiophen-2-yl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate.
| Compound Name | ethyl (4R)-2-amino-4-(3-methylthiophen-2-yl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 1284275 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | ethyl (4R)-2-amino-4-(3-methylthiophen-2-yl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2c(c(=O)oc3ccccc23)[C@H]1c1sccc1C |
| InChI | InChI=1S/C20H17NO5S/c1-3-24-19(22)15-13(17-10(2)8-9-27-17)14-16(26-18(15)21)11-6-4-5-7-12(11)25-20(14)23/h4-9,13H,3,21H2,1-2H3/t13-/m1/s1 |
| InChIKey | GYFZPNLWHNQQFA-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|