C26H18N2O6S — CID 5128513
[4-(2-amino-3-cyano-5-oxo-4H-pyrano[3,2-c]chromen-4-yl)-2-ethoxyphenyl] thiophene-2-carboxylate (PubChem CID 5128513) has the molecular formula C26H18N2O6S and a molecular weight of 486.51 g/mol. Its IUPAC name is [4-(2-amino-3-cyano-5-oxo-4H-pyrano[3,2-c]chromen-4-yl)-2-ethoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-(2-amino-3-cyano-5-oxo-4H-pyrano[3,2-c]chromen-4-yl)-2-ethoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5128513 |
| Molecular Formula | C26H18N2O6S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | [4-(2-amino-3-cyano-5-oxo-4H-pyrano[3,2-c]chromen-4-yl)-2-ethoxyphenyl] thiophene-2-carboxylate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C26H18N2O6S/c1-2-31-19-12-14(9-10-18(19)33-25(29)20-8-5-11-35-20)21-16(13-27)24(28)34-23-15-6-3-4-7-17(15)32-26(30)22(21)23/h3-12,21H,2,28H2,1H3 |
| InChIKey | JSMHPUXGKHOZIB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|