C21H15F2NO5 — CID 1002261
ethyl (4S)-2-amino-4-(2,4-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate (PubChem CID 1002261) has the molecular formula C21H15F2NO5 and a molecular weight of 399.35 g/mol. Its IUPAC name is ethyl (4S)-2-amino-4-(2,4-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate.
| Compound Name | ethyl (4S)-2-amino-4-(2,4-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 1002261 |
| Molecular Formula | C21H15F2NO5 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | ethyl (4S)-2-amino-4-(2,4-difluorophenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2c(c(=O)oc3ccccc23)[C@@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F2NO5/c1-2-27-20(25)17-15(11-8-7-10(22)9-13(11)23)16-18(29-19(17)24)12-5-3-4-6-14(12)28-21(16)26/h3-9,15H,2,24H2,1H3/t15-/m0/s1 |
| InChIKey | CUESTXISHWZOQU-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|