C29H26O5 — CID 164853935
diethyl 1-(4-phenylphenyl)-1,3-dihydrocyclopenta[b][1]benzofuran-2,2-dicarboxylate (PubChem CID 164853935) has the molecular formula C29H26O5 and a molecular weight of 454.52 g/mol. Its IUPAC name is diethyl 1-(4-phenylphenyl)-1,3-dihydrocyclopenta[b][1]benzofuran-2,2-dicarboxylate.
| Compound Name | diethyl 1-(4-phenylphenyl)-1,3-dihydrocyclopenta[b][1]benzofuran-2,2-dicarboxylate |
|---|---|
| PubChem CID | 164853935 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | diethyl 1-(4-phenylphenyl)-1,3-dihydrocyclopenta[b][1]benzofuran-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2oc3ccccc3c2C1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26O5/c1-3-32-27(30)29(28(31)33-4-2)18-24-25(22-12-8-9-13-23(22)34-24)26(29)21-16-14-20(15-17-21)19-10-6-5-7-11-19/h5-17,26H,3-4,18H2,1-2H3 |
| InChIKey | VRHHHCIOIAAMLB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|