C22H24O5 — CID 11003125
diethyl 6-hydroxy-1-methyl-7-phenyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 11003125) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is diethyl 6-hydroxy-1-methyl-7-phenyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 6-hydroxy-1-methyl-7-phenyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11003125 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | diethyl 6-hydroxy-1-methyl-7-phenyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2ccc(O)c(-c3ccccc3)c2C1C |
| InChI | InChI=1S/C22H24O5/c1-4-26-20(24)22(21(25)27-5-2)13-16-11-12-17(23)19(18(16)14(22)3)15-9-7-6-8-10-15/h6-12,14,23H,4-5,13H2,1-3H3 |
| InChIKey | FRCGCHYRDXDZHL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|