C23H28O5 — CID 11349630
diethyl (1S,5S)-4-methylidene-10-oxo-1-phenylspiro[4.5]decane-2,2-dicarboxylate (PubChem CID 11349630) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is diethyl (1S,5S)-4-methylidene-10-oxo-1-phenylspiro[4.5]decane-2,2-dicarboxylate.
| Compound Name | diethyl (1S,5S)-4-methylidene-10-oxo-1-phenylspiro[4.5]decane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11349630 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | diethyl (1S,5S)-4-methylidene-10-oxo-1-phenylspiro[4.5]decane-2,2-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@@H](c2ccccc2)[C@@]12CCCCC2=O |
| InChI | InChI=1S/C23H28O5/c1-4-27-20(25)23(21(26)28-5-2)15-16(3)22(14-10-9-13-18(22)24)19(23)17-11-7-6-8-12-17/h6-8,11-12,19H,3-5,9-10,13-15H2,1-2H3/t19-,22-/m0/s1 |
| InChIKey | XQDXFVAKXZMZIP-UGKGYDQZSA-N |
| XLogP | 3.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|