C18H22O5 — CID 72672577
diethyl 3-formyl-2-phenylcyclopentane-1,1-dicarboxylate (PubChem CID 72672577) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is diethyl 3-formyl-2-phenylcyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-formyl-2-phenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 72672577 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | diethyl 3-formyl-2-phenylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(C=O)C1c1ccccc1 |
| InChI | InChI=1S/C18H22O5/c1-3-22-16(20)18(17(21)23-4-2)11-10-14(12-19)15(18)13-8-6-5-7-9-13/h5-9,12,14-15H,3-4,10-11H2,1-2H3 |
| InChIKey | PWPKDXRLDAQYNJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|