C29H30O6 — CID 59398687
diethyl 5,6-bis(hydroxymethyl)-4,7-diphenyl-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 59398687) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is diethyl 5,6-bis(hydroxymethyl)-4,7-diphenyl-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | diethyl 5,6-bis(hydroxymethyl)-4,7-diphenyl-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 59398687 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | diethyl 5,6-bis(hydroxymethyl)-4,7-diphenyl-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c(c(-c3ccccc3)c(CO)c(CO)c2-c2ccccc2)C1 |
| InChI | InChI=1S/C29H30O6/c1-3-34-27(32)29(28(33)35-4-2)15-21-22(16-29)26(20-13-9-6-10-14-20)24(18-31)23(17-30)25(21)19-11-7-5-8-12-19/h5-14,30-31H,3-4,15-18H2,1-2H3 |
| InChIKey | RQVILHGPNYVQGI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|