C20H24O4 — CID 46210382
diethyl (3Z,4E)-3-benzylidene-4-(1-deuterioethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 46210382) has the molecular formula C20H24O4 and a molecular weight of 329.41 g/mol. Its IUPAC name is diethyl (3Z,4E)-3-benzylidene-4-(1-deuterioethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (3Z,4E)-3-benzylidene-4-(1-deuterioethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 46210382 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | diethyl (3Z,4E)-3-benzylidene-4-(1-deuterioethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | [2H]/C(C)=C1/CC(C(=O)OCC)(C(=O)OCC)C/C1=C/c1ccccc1 |
| InChI | InChI=1S/C20H24O4/c1-4-16-13-20(18(21)23-5-2,19(22)24-6-3)14-17(16)12-15-10-8-7-9-11-15/h4,7-12H,5-6,13-14H2,1-3H3/b16-4+,17-12-/i4D |
| InChIKey | WCATXYKVOPDCTG-GELFJMEASA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|