C15H18O2 — CID 134865085
ethyl 1-[(E)-3-phenylprop-2-enyl]cyclopropane-1-carboxylate (PubChem CID 134865085) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is ethyl 1-[(E)-3-phenylprop-2-enyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[(E)-3-phenylprop-2-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134865085 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | ethyl 1-[(E)-3-phenylprop-2-enyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C15H18O2/c1-2-17-14(16)15(11-12-15)10-6-9-13-7-4-3-5-8-13/h3-9H,2,10-12H2,1H3/b9-6+ |
| InChIKey | JKCJJPDIXRXVMQ-RMKNXTFCSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |