C21H27N3O2 — CID 45251716
ethyl 1-(1H-imidazol-2-ylmethyl)-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate (PubChem CID 45251716) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethyl 1-(1H-imidazol-2-ylmethyl)-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-(1H-imidazol-2-ylmethyl)-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 45251716 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | ethyl 1-(1H-imidazol-2-ylmethyl)-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C/C=C/c2ccccc2)CCCN(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C21H27N3O2/c1-2-26-20(25)21(11-6-10-18-8-4-3-5-9-18)12-7-15-24(17-21)16-19-22-13-14-23-19/h3-6,8-10,13-14H,2,7,11-12,15-17H2,1H3,(H,22,23)/b10-6+ |
| InChIKey | CKEILCDWWWGNPV-UXBLZVDNSA-N |
| XLogP | 3.66 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |