C21H29NO2 — CID 25453067
ethyl (3S)-1-cyclobutyl-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate (PubChem CID 25453067) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is ethyl (3S)-1-cyclobutyl-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-cyclobutyl-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25453067 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | ethyl (3S)-1-cyclobutyl-3-[(E)-3-phenylprop-2-enyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C/C=C/c2ccccc2)CCCN(C2CCC2)C1 |
| InChI | InChI=1S/C21H29NO2/c1-2-24-20(23)21(14-7-11-18-9-4-3-5-10-18)15-8-16-22(17-21)19-12-6-13-19/h3-5,7,9-11,19H,2,6,8,12-17H2,1H3/b11-7+/t21-/m1/s1 |
| InChIKey | ZYXIAJPEKKTRAD-FTUXVVSKSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |