C23H36N2O2 — CID 28732842
ethyl (3S)-3-benzyl-1-(1-propylpiperidin-4-yl)piperidine-3-carboxylate (PubChem CID 28732842) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is ethyl (3S)-3-benzyl-1-(1-propylpiperidin-4-yl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-3-benzyl-1-(1-propylpiperidin-4-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 28732842 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | ethyl (3S)-3-benzyl-1-(1-propylpiperidin-4-yl)piperidine-3-carboxylate |
| SMILES | CCCN1CCC(N2CCC[C@@](Cc3ccccc3)(C(=O)OCC)C2)CC1 |
| InChI | InChI=1S/C23H36N2O2/c1-3-14-24-16-11-21(12-17-24)25-15-8-13-23(19-25,22(26)27-4-2)18-20-9-6-5-7-10-20/h5-7,9-10,21H,3-4,8,11-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | BMDGAEKUZCTZEV-QHCPKHFHSA-N |
| XLogP | 3.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |