C25H32N2O4 — CID 10623867
ethyl (3S)-1-[(2R)-2-amino-3-phenylmethoxypropanoyl]-3-benzylpiperidine-3-carboxylate (PubChem CID 10623867) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl (3S)-1-[(2R)-2-amino-3-phenylmethoxypropanoyl]-3-benzylpiperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(2R)-2-amino-3-phenylmethoxypropanoyl]-3-benzylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 10623867 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | ethyl (3S)-1-[(2R)-2-amino-3-phenylmethoxypropanoyl]-3-benzylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(Cc2ccccc2)CCCN(C(=O)[C@H](N)COCc2ccccc2)C1 |
| InChI | InChI=1S/C25H32N2O4/c1-2-31-24(29)25(16-20-10-5-3-6-11-20)14-9-15-27(19-25)23(28)22(26)18-30-17-21-12-7-4-8-13-21/h3-8,10-13,22H,2,9,14-19,26H2,1H3/t22-,25+/m1/s1 |
| InChIKey | QSOIIUXQOYWNBC-RDGATRHJSA-N |
| XLogP | 2.95 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |