C19H27ClN2O3 — CID 26390875
ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(propan-2-ylcarbamoyl)piperidine-3-carboxylate (PubChem CID 26390875) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(propan-2-ylcarbamoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(propan-2-ylcarbamoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26390875 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(propan-2-ylcarbamoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2cccc(Cl)c2)CCCN(C(=O)NC(C)C)C1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-4-25-17(23)19(12-15-7-5-8-16(20)11-15)9-6-10-22(13-19)18(24)21-14(2)3/h5,7-8,11,14H,4,6,9-10,12-13H2,1-3H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | KPAITOIIJBVYNV-LJQANCHMSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |