C20H22ClNO3S — CID 26396230
ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxylate (PubChem CID 26396230) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26396230 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | ethyl (3R)-3-[(3-chlorophenyl)methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-2-25-19(24)20(13-15-6-3-7-16(21)12-15)9-5-10-22(14-20)18(23)17-8-4-11-26-17/h3-4,6-8,11-12H,2,5,9-10,13-14H2,1H3/t20-/m1/s1 |
| InChIKey | DHVHTGJKUCAFOA-HXUWFJFHSA-N |
| XLogP | 4.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |