C29H41N5O4 — CID 18365182
2-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-2-methylpropanamide (PubChem CID 18365182) has the molecular formula C29H41N5O4 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-2-methylpropanamide.
| Compound Name | 2-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 18365182 |
| Molecular Formula | C29H41N5O4 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 2-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-2-methylpropanamide |
| SMILES | CN(C)NC(=O)C1(Cc2ccccc2)CCCN(C(=O)C(COCc2ccccc2)NC(=O)C(C)(C)N)C1 |
| InChI | InChI=1S/C29H41N5O4/c1-28(2,30)26(36)31-24(20-38-19-23-14-9-6-10-15-23)25(35)34-17-11-16-29(21-34,27(37)32-33(3)4)18-22-12-7-5-8-13-22/h5-10,12-15,24H,11,16-21,30H2,1-4H3,(H,31,36)(H,32,37) |
| InChIKey | VYBJANBOQVYIAI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|