C32H45N5O4 — CID 20694709
(E)-5-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-5-methylhex-2-enamide (PubChem CID 20694709) has the molecular formula C32H45N5O4 and a molecular weight of 563.74 g/mol. Its IUPAC name is (E)-5-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-5-methylhex-2-enamide.
| Compound Name | (E)-5-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-5-methylhex-2-enamide |
|---|---|
| PubChem CID | 20694709 |
| Molecular Formula | C32H45N5O4 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | (E)-5-amino-N-[1-[3-benzyl-3-(dimethylaminocarbamoyl)piperidin-1-yl]-1-oxo-3-phenylmethoxypropan-2-yl]-5-methylhex-2-enamide |
| SMILES | CN(C)NC(=O)C1(Cc2ccccc2)CCCN(C(=O)C(COCc2ccccc2)NC(=O)/C=C/CC(C)(C)N)C1 |
| InChI | InChI=1S/C32H45N5O4/c1-31(2,33)18-11-17-28(38)34-27(23-41-22-26-15-9-6-10-16-26)29(39)37-20-12-19-32(24-37,30(40)35-36(3)4)21-25-13-7-5-8-14-25/h5-11,13-17,27H,12,18-24,33H2,1-4H3,(H,34,38)(H,35,40)/b17-11+ |
| InChIKey | MKTHSCLUBYKWJU-GZTJUZNOSA-N |
| XLogP | 2.82 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|