C33H42N4O5 — CID 69024229
[(3S)-1-[(2R)-2-[[(E)-5-amino-5-methylhex-2-enoyl]amino]-3-(1H-indol-3-yl)propanoyl]-3-benzylpiperidin-3-yl] ethyl carbonate (PubChem CID 69024229) has the molecular formula C33H42N4O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is [(3S)-1-[(2R)-2-[[(E)-5-amino-5-methylhex-2-enoyl]amino]-3-(1H-indol-3-yl)propanoyl]-3-benzylpiperidin-3-yl] ethyl carbonate.
| Compound Name | [(3S)-1-[(2R)-2-[[(E)-5-amino-5-methylhex-2-enoyl]amino]-3-(1H-indol-3-yl)propanoyl]-3-benzylpiperidin-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 69024229 |
| Molecular Formula | C33H42N4O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | [(3S)-1-[(2R)-2-[[(E)-5-amino-5-methylhex-2-enoyl]amino]-3-(1H-indol-3-yl)propanoyl]-3-benzylpiperidin-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@]1(Cc2ccccc2)CCCN(C(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)/C=C/CC(C)(C)N)C1 |
| InChI | InChI=1S/C33H42N4O5/c1-4-41-31(40)42-33(21-24-12-6-5-7-13-24)18-11-19-37(23-33)30(39)28(36-29(38)16-10-17-32(2,3)34)20-25-22-35-27-15-9-8-14-26(25)27/h5-10,12-16,22,28,35H,4,11,17-21,23,34H2,1-3H3,(H,36,38)/b16-10+/t28-,33+/m1/s1 |
| InChIKey | QMCMPJAQWLTXDS-KYXWVJMWSA-N |
| XLogP | 4.66 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|