C21H26O4 — CID 24949820
diethyl 3-methyl-4-[(Z)-2-(2-methylphenyl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 24949820) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is diethyl 3-methyl-4-[(Z)-2-(2-methylphenyl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | diethyl 3-methyl-4-[(Z)-2-(2-methylphenyl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 24949820 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | diethyl 3-methyl-4-[(Z)-2-(2-methylphenyl)ethenyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)=C(/C=C\c2ccccc2C)C1 |
| InChI | InChI=1S/C21H26O4/c1-5-24-19(22)21(20(23)25-6-2)13-16(4)18(14-21)12-11-17-10-8-7-9-15(17)3/h7-12H,5-6,13-14H2,1-4H3/b12-11- |
| InChIKey | UFIHQSHOUGXXHN-QXMHVHEDSA-N |
| XLogP | 4.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|