C20H24O5 — CID 15498417
diethyl (5S,6R)-5-benzoyl-6-methylcyclohex-3-ene-1,1-dicarboxylate (PubChem CID 15498417) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is diethyl (5S,6R)-5-benzoyl-6-methylcyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | diethyl (5S,6R)-5-benzoyl-6-methylcyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15498417 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | diethyl (5S,6R)-5-benzoyl-6-methylcyclohex-3-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC=C[C@H](C(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C20H24O5/c1-4-24-18(22)20(19(23)25-5-2)13-9-12-16(14(20)3)17(21)15-10-7-6-8-11-15/h6-12,14,16H,4-5,13H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | NPFSEHDWAUYDFK-ZBFHGGJFSA-N |
| XLogP | 3.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|