C27H20N2O3 — CID 156767207
trans-ethyl (1R,2R)-2-benzoyl-1-(2,2-dicyano-1-naphthalen-2-ylethenyl)cyclopropane-1-carboxylate (PubChem CID 156767207) has the molecular formula C27H20N2O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-benzoyl-1-(2,2-dicyano-1-naphthalen-2-ylethenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-benzoyl-1-(2,2-dicyano-1-naphthalen-2-ylethenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 156767207 |
| Molecular Formula | C27H20N2O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | trans-ethyl (1R,2R)-2-benzoyl-1-(2,2-dicyano-1-naphthalen-2-ylethenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(=C(C#N)C#N)c2ccc3ccccc3c2)C[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O3/c1-2-32-26(31)27(15-23(27)25(30)19-9-4-3-5-10-19)24(22(16-28)17-29)21-13-12-18-8-6-7-11-20(18)14-21/h3-14,23H,2,15H2,1H3/t23-,27+/m0/s1 |
| InChIKey | CUJBWPVXPAOMKH-WNCULLNHSA-N |
| XLogP | 5.09 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|