C28H29NO7 — CID 164677207
diethyl (2S,3R,4R)-3-benzoyl-2-(4-cyanophenyl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 164677207) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is diethyl (2S,3R,4R)-3-benzoyl-2-(4-cyanophenyl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (2S,3R,4R)-3-benzoyl-2-(4-cyanophenyl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 164677207 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | diethyl (2S,3R,4R)-3-benzoyl-2-(4-cyanophenyl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](CC(=O)OC)[C@@H](C(=O)c2ccccc2)[C@H]1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H29NO7/c1-4-35-26(32)28(27(33)36-5-2)16-21(15-22(30)34-3)23(25(31)20-9-7-6-8-10-20)24(28)19-13-11-18(17-29)12-14-19/h6-14,21,23-24H,4-5,15-16H2,1-3H3/t21-,23+,24+/m0/s1 |
| InChIKey | AFYYFRMSKUYSPF-QPTUXGOLSA-N |
| XLogP | 3.84 |
| TPSA | 119.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|