C16H17NO3S — CID 102081197
ethyl 2-[(3S,4R,5S)-5-(4-cyanophenyl)-4-formylthiolan-3-yl]acetate (PubChem CID 102081197) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is ethyl 2-[(3S,4R,5S)-5-(4-cyanophenyl)-4-formylthiolan-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4R,5S)-5-(4-cyanophenyl)-4-formylthiolan-3-yl]acetate |
|---|---|
| PubChem CID | 102081197 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 2-[(3S,4R,5S)-5-(4-cyanophenyl)-4-formylthiolan-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CS[C@H](c2ccc(C#N)cc2)[C@H]1C=O |
| InChI | InChI=1S/C16H17NO3S/c1-2-20-15(19)7-13-10-21-16(14(13)9-18)12-5-3-11(8-17)4-6-12/h3-6,9,13-14,16H,2,7,10H2,1H3/t13-,14+,16-/m1/s1 |
| InChIKey | VJTHECOQVNFZGU-IJEWVQPXSA-N |
| XLogP | 2.73 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|