C16H16N2O5 — CID 25155766
methyl 2-[(1S,2S,3S,4R)-3-(4-cyanophenyl)-2-formyl-4-nitrocyclopentyl]acetate (PubChem CID 25155766) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 2-[(1S,2S,3S,4R)-3-(4-cyanophenyl)-2-formyl-4-nitrocyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,2S,3S,4R)-3-(4-cyanophenyl)-2-formyl-4-nitrocyclopentyl]acetate |
|---|---|
| PubChem CID | 25155766 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 2-[(1S,2S,3S,4R)-3-(4-cyanophenyl)-2-formyl-4-nitrocyclopentyl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H]([N+](=O)[O-])[C@H](c2ccc(C#N)cc2)[C@H]1C=O |
| InChI | InChI=1S/C16H16N2O5/c1-23-15(20)7-12-6-14(18(21)22)16(13(12)9-19)11-4-2-10(8-17)3-5-11/h2-5,9,12-14,16H,6-7H2,1H3/t12-,13-,14+,16+/m0/s1 |
| InChIKey | HCYWZYZLAHQIRQ-TTZDDIAXSA-N |
| XLogP | 1.69 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|