C16H18FNO5 — CID 102428641
ethyl 2-[(1R,2S,3R,4R)-3-(4-fluorophenyl)-4-formyl-2-nitrocyclopentyl]acetate (PubChem CID 102428641) has the molecular formula C16H18FNO5 and a molecular weight of 323.32 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,3R,4R)-3-(4-fluorophenyl)-4-formyl-2-nitrocyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,2S,3R,4R)-3-(4-fluorophenyl)-4-formyl-2-nitrocyclopentyl]acetate |
|---|---|
| PubChem CID | 102428641 |
| Molecular Formula | C16H18FNO5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethyl 2-[(1R,2S,3R,4R)-3-(4-fluorophenyl)-4-formyl-2-nitrocyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](C=O)[C@H](c2ccc(F)cc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18FNO5/c1-2-23-14(20)8-11-7-12(9-19)15(16(11)18(21)22)10-3-5-13(17)6-4-10/h3-6,9,11-12,15-16H,2,7-8H2,1H3/t11-,12+,15+,16+/m1/s1 |
| InChIKey | ZEMITONZZCYESV-KNPMLCFXSA-N |
| XLogP | 2.34 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|