C16H19NO5 — CID 102577776
ethyl 2-[(1S,2S,3S,4R)-2-formyl-4-nitro-3-phenylcyclopentyl]acetate (PubChem CID 102577776) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,3S,4R)-2-formyl-4-nitro-3-phenylcyclopentyl]acetate.
| Compound Name | ethyl 2-[(1S,2S,3S,4R)-2-formyl-4-nitro-3-phenylcyclopentyl]acetate |
|---|---|
| PubChem CID | 102577776 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl 2-[(1S,2S,3S,4R)-2-formyl-4-nitro-3-phenylcyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@@H]([N+](=O)[O-])[C@H](c2ccccc2)[C@H]1C=O |
| InChI | InChI=1S/C16H19NO5/c1-2-22-15(19)9-12-8-14(17(20)21)16(13(12)10-18)11-6-4-3-5-7-11/h3-7,10,12-14,16H,2,8-9H2,1H3/t12-,13-,14+,16+/m0/s1 |
| InChIKey | AOOUTKNGWVFIMG-TTZDDIAXSA-N |
| XLogP | 2.20 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|