C20H23NO7 — CID 68774470
1-acetyl-4-(2-ethoxy-2-oxoethyl)-3-nitro-2-(2-phenylethenyl)cyclopentane-1-carboxylic acid (PubChem CID 68774470) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is 1-acetyl-4-(2-ethoxy-2-oxoethyl)-3-nitro-2-(2-phenylethenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-acetyl-4-(2-ethoxy-2-oxoethyl)-3-nitro-2-(2-phenylethenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 68774470 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-acetyl-4-(2-ethoxy-2-oxoethyl)-3-nitro-2-(2-phenylethenyl)cyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)CC1CC(C(C)=O)(C(=O)O)C(C=Cc2ccccc2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23NO7/c1-3-28-17(23)11-15-12-20(13(2)22,19(24)25)16(18(15)21(26)27)10-9-14-7-5-4-6-8-14/h4-10,15-16,18H,3,11-12H2,1-2H3,(H,24,25) |
| InChIKey | YQKFHFKMHHRAIX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|