C19H21NO7 — CID 139257400
ethyl 2-(2-ethoxy-2-oxoethyl)-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,3-dihydrofuran-4-carboxylate (PubChem CID 139257400) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-2-oxoethyl)-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl 2-(2-ethoxy-2-oxoethyl)-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 139257400 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | ethyl 2-(2-ethoxy-2-oxoethyl)-5-[(E)-2-(2-nitrophenyl)ethenyl]-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)CC1CC(C(=O)OCC)=C(/C=C/c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C19H21NO7/c1-3-25-18(21)12-14-11-15(19(22)26-4-2)17(27-14)10-9-13-7-5-6-8-16(13)20(23)24/h5-10,14H,3-4,11-12H2,1-2H3/b10-9+ |
| InChIKey | KJVPHDGOABKNDS-MDZDMXLPSA-N |
| XLogP | 3.17 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|