C19H24O4 — CID 101382561
trans-diethyl (2S,3S)-2-ethyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 101382561) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is trans-diethyl (2S,3S)-2-ethyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2S,3S)-2-ethyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101382561 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | trans-diethyl (2S,3S)-2-ethyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](/C=C/c2ccccc2)[C@@H]1CC |
| InChI | InChI=1S/C19H24O4/c1-4-15-16(13-12-14-10-8-7-9-11-14)19(15,17(20)22-5-2)18(21)23-6-3/h7-13,15-16H,4-6H2,1-3H3/b13-12+/t15-,16-/m0/s1 |
| InChIKey | QSAKCGFNOLEJFN-XADBSNKSSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|