C16H18O4 — CID 15348856
cis-dimethyl (2R,3S)-2-methyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate (PubChem CID 15348856) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is cis-dimethyl (2R,3S)-2-methyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2R,3S)-2-methyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15348856 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | cis-dimethyl (2R,3S)-2-methyl-3-[(E)-2-phenylethenyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@H](C)[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H18O4/c1-11-13(10-9-12-7-5-4-6-8-12)16(11,14(17)19-2)15(18)20-3/h4-11,13H,1-3H3/b10-9+/t11-,13+/m1/s1 |
| InChIKey | JTHBYNVJUKWWNV-FCSPZMLESA-N |
| XLogP | 2.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|