C23H28N2O5 — CID 132533004
ethyl 2-[(2S,3R,4S)-1-benzyl-2-(4-methoxyphenyl)-3-nitropiperidin-4-yl]acetate (PubChem CID 132533004) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4S)-1-benzyl-2-(4-methoxyphenyl)-3-nitropiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4S)-1-benzyl-2-(4-methoxyphenyl)-3-nitropiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 132533004 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | ethyl 2-[(2S,3R,4S)-1-benzyl-2-(4-methoxyphenyl)-3-nitropiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCN(Cc2ccccc2)C(c2ccc(OC)cc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N2O5/c1-3-30-21(26)15-19-13-14-24(16-17-7-5-4-6-8-17)22(23(19)25(27)28)18-9-11-20(29-2)12-10-18/h4-12,19,22-23H,3,13-16H2,1-2H3/t19-,22?,23+/m0/s1 |
| InChIKey | KMLGDSIBHZCBBD-IQWVOLIVSA-N |
| XLogP | 3.86 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|