C19H29NO2 — CID 146168791
ethyl 2-[(2R,3R)-1-benzyl-2-tert-butylpyrrolidin-3-yl]acetate (PubChem CID 146168791) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is ethyl 2-[(2R,3R)-1-benzyl-2-tert-butylpyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2R,3R)-1-benzyl-2-tert-butylpyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 146168791 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 2-[(2R,3R)-1-benzyl-2-tert-butylpyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCN(Cc2ccccc2)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C19H29NO2/c1-5-22-17(21)13-16-11-12-20(18(16)19(2,3)4)14-15-9-7-6-8-10-15/h6-10,16,18H,5,11-14H2,1-4H3/t16-,18-/m1/s1 |
| InChIKey | SCTSTSKAJPACDJ-SJLPKXTDSA-N |
| XLogP | 3.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |