C23H27NO3 — CID 132532994
ethyl 2-[(2S,3S,4S)-1-benzyl-3-formyl-2-phenylpiperidin-4-yl]acetate (PubChem CID 132532994) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4S)-1-benzyl-3-formyl-2-phenylpiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4S)-1-benzyl-3-formyl-2-phenylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 132532994 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl 2-[(2S,3S,4S)-1-benzyl-3-formyl-2-phenylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCN(Cc2ccccc2)[C@H](c2ccccc2)[C@H]1C=O |
| InChI | InChI=1S/C23H27NO3/c1-2-27-22(26)15-20-13-14-24(16-18-9-5-3-6-10-18)23(21(20)17-25)19-11-7-4-8-12-19/h3-12,17,20-21,23H,2,13-16H2,1H3/t20-,21-,23+/m0/s1 |
| InChIKey | MPMAOBDJFBHGAC-QNWVGRARSA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|