C16H17NO3 — CID 166439618
methyl (1R,2S,3R,4R)-1-cyano-3-formyl-4-methyl-2-phenylcyclopentane-1-carboxylate (PubChem CID 166439618) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl (1R,2S,3R,4R)-1-cyano-3-formyl-4-methyl-2-phenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4R)-1-cyano-3-formyl-4-methyl-2-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 166439618 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl (1R,2S,3R,4R)-1-cyano-3-formyl-4-methyl-2-phenylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C#N)C[C@@H](C)[C@@H](C=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c1-11-8-16(10-17,15(19)20-2)14(13(11)9-18)12-6-4-3-5-7-12/h3-7,9,11,13-14H,8H2,1-2H3/t11-,13-,14-,16+/m1/s1 |
| InChIKey | RYGUQGFMVAZJFM-MEWXFMAXSA-N |
| XLogP | 2.31 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|