C24H25NO4 — CID 24894966
ethyl (1S,2S,3R,4R,5S)-1-cyano-3-formyl-4-hydroxy-5-methyl-2,5-diphenylcyclohexane-1-carboxylate (PubChem CID 24894966) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl (1S,2S,3R,4R,5S)-1-cyano-3-formyl-4-hydroxy-5-methyl-2,5-diphenylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3R,4R,5S)-1-cyano-3-formyl-4-hydroxy-5-methyl-2,5-diphenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 24894966 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | ethyl (1S,2S,3R,4R,5S)-1-cyano-3-formyl-4-hydroxy-5-methyl-2,5-diphenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)C[C@@](C)(c2ccccc2)[C@H](O)[C@H](C=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO4/c1-3-29-22(28)24(16-25)15-23(2,18-12-8-5-9-13-18)21(27)19(14-26)20(24)17-10-6-4-7-11-17/h4-14,19-21,27H,3,15H2,1-2H3/t19-,20-,21-,23+,24-/m1/s1 |
| InChIKey | GFDOVDXCUVNZIH-AJTZHXEGSA-N |
| XLogP | 3.38 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|