C35H31NO4 — CID 124723949
ethyl (1R,2S,3S,4R,6S)-3-benzoyl-1-cyano-4-hydroxy-2,4,6-triphenylcyclohexane-1-carboxylate (PubChem CID 124723949) has the molecular formula C35H31NO4 and a molecular weight of 529.64 g/mol. Its IUPAC name is ethyl (1R,2S,3S,4R,6S)-3-benzoyl-1-cyano-4-hydroxy-2,4,6-triphenylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3S,4R,6S)-3-benzoyl-1-cyano-4-hydroxy-2,4,6-triphenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 124723949 |
| Molecular Formula | C35H31NO4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | ethyl (1R,2S,3S,4R,6S)-3-benzoyl-1-cyano-4-hydroxy-2,4,6-triphenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@H](c2ccccc2)[C@H](C(=O)c2ccccc2)[C@@](O)(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C35H31NO4/c1-2-40-33(38)34(24-36)29(25-15-7-3-8-16-25)23-35(39,28-21-13-6-14-22-28)31(30(34)26-17-9-4-10-18-26)32(37)27-19-11-5-12-20-27/h3-22,29-31,39H,2,23H2,1H3/t29-,30+,31+,34+,35-/m0/s1 |
| InChIKey | XNUIOMJMFRIAHR-IRPXJGOYSA-N |
| XLogP | 6.42 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |