C35H29Cl2NO4 — CID 124764612
ethyl (1R,2S,3R,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-diphenylcyclohexane-1-carboxylate (PubChem CID 124764612) has the molecular formula C35H29Cl2NO4 and a molecular weight of 598.53 g/mol. Its IUPAC name is ethyl (1R,2S,3R,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-diphenylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3R,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-diphenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 124764612 |
| Molecular Formula | C35H29Cl2NO4 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | ethyl (1R,2S,3R,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-diphenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@H](c2ccccc2)[C@@H](C(=O)c2ccc(Cl)cc2)[C@@](O)(c2ccc(Cl)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C35H29Cl2NO4/c1-2-42-33(40)34(22-38)29(23-9-5-3-6-10-23)21-35(41,26-15-19-28(37)20-16-26)31(30(34)24-11-7-4-8-12-24)32(39)25-13-17-27(36)18-14-25/h3-20,29-31,41H,2,21H2,1H3/t29-,30+,31-,34+,35-/m0/s1 |
| InChIKey | DPRXSYGUKXKSER-RDCWZDOOSA-N |
| XLogP | 7.72 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |