C35H27Cl4NO4 — CID 7271922
ethyl (1R,2S,3R,4R,6S)-3-benzoyl-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-4-phenylcyclohexane-1-carboxylate (PubChem CID 7271922) has the molecular formula C35H27Cl4NO4 and a molecular weight of 667.42 g/mol. Its IUPAC name is ethyl (1R,2S,3R,4R,6S)-3-benzoyl-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-4-phenylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3R,4R,6S)-3-benzoyl-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-4-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7271922 |
| Molecular Formula | C35H27Cl4NO4 |
| Molecular Weight | 667.42 g/mol |
| Exact Mass | 665.07 |
| IUPAC Name | ethyl (1R,2S,3R,4R,6S)-3-benzoyl-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-4-phenylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@H](c2ccc(Cl)c(Cl)c2)[C@@H](C(=O)c2ccccc2)[C@@](O)(c2ccccc2)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C35H27Cl4NO4/c1-2-44-33(42)34(20-40)25(22-13-15-26(36)28(38)17-22)19-35(43,24-11-7-4-8-12-24)31(32(41)21-9-5-3-6-10-21)30(34)23-14-16-27(37)29(39)18-23/h3-18,25,30-31,43H,2,19H2,1H3/t25-,30+,31-,34+,35-/m0/s1 |
| InChIKey | PWWBCLJSKVOECF-MTVVFAOMSA-N |
| XLogP | 9.03 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.42 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |