C42H29Cl4NO4 — CID 99682607
methyl (1R,2R,3R,4R,6S)-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-3-(naphthalene-2-carbonyl)-4-naphthalen-2-ylcyclohexane-1-carboxylate (PubChem CID 99682607) has the molecular formula C42H29Cl4NO4 and a molecular weight of 753.51 g/mol. Its IUPAC name is methyl (1R,2R,3R,4R,6S)-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-3-(naphthalene-2-carbonyl)-4-naphthalen-2-ylcyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R,4R,6S)-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-3-(naphthalene-2-carbonyl)-4-naphthalen-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 99682607 |
| Molecular Formula | C42H29Cl4NO4 |
| Molecular Weight | 753.51 g/mol |
| Exact Mass | 751.09 |
| IUPAC Name | methyl (1R,2R,3R,4R,6S)-1-cyano-2,6-bis(3,4-dichlorophenyl)-4-hydroxy-3-(naphthalene-2-carbonyl)-4-naphthalen-2-ylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C#N)[C@H](c2ccc(Cl)c(Cl)c2)C[C@](O)(c2ccc3ccccc3c2)[C@H](C(=O)c2ccc3ccccc3c2)[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C42H29Cl4NO4/c1-51-40(49)41(23-47)32(28-13-16-33(43)35(45)20-28)22-42(50,31-15-12-25-7-3-5-9-27(25)19-31)38(37(41)29-14-17-34(44)36(46)21-29)39(48)30-11-10-24-6-2-4-8-26(24)18-30/h2-21,32,37-38,50H,22H2,1H3/t32-,37-,38-,41+,42-/m0/s1 |
| InChIKey | CEZWFUSDFUFGIB-IPRBCUQGSA-N |
| XLogP | 10.95 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.51 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |