C37H33Cl2NO6 — CID 124764680
ethyl (1R,2S,3S,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(4-methoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 124764680) has the molecular formula C37H33Cl2NO6 and a molecular weight of 658.58 g/mol. Its IUPAC name is ethyl (1R,2S,3S,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(4-methoxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3S,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(4-methoxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 124764680 |
| Molecular Formula | C37H33Cl2NO6 |
| Molecular Weight | 658.58 g/mol |
| Exact Mass | 657.17 |
| IUPAC Name | ethyl (1R,2S,3S,4R,6S)-3-(4-chlorobenzoyl)-4-(4-chlorophenyl)-1-cyano-4-hydroxy-2,6-bis(4-methoxyphenyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@H](c2ccc(OC)cc2)[C@H](C(=O)c2ccc(Cl)cc2)[C@@](O)(c2ccc(Cl)cc2)C[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C37H33Cl2NO6/c1-4-46-35(42)36(22-40)31(23-7-17-29(44-2)18-8-23)21-37(43,26-11-15-28(39)16-12-26)33(34(41)25-5-13-27(38)14-6-25)32(36)24-9-19-30(45-3)20-10-24/h5-20,31-33,43H,4,21H2,1-3H3/t31-,32+,33+,36+,37-/m0/s1 |
| InChIKey | GBJXNJYFFXVPQP-ZQBSIFDSSA-N |
| XLogP | 7.74 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.58 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |