C35H27Br2Cl2NO4 — CID 99682372
ethyl (1S,2R,3R,4R,6S)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2,6-bis(4-chlorophenyl)-1-cyano-4-hydroxycyclohexane-1-carboxylate (PubChem CID 99682372) has the molecular formula C35H27Br2Cl2NO4 and a molecular weight of 756.32 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R,6S)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2,6-bis(4-chlorophenyl)-1-cyano-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R,6S)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2,6-bis(4-chlorophenyl)-1-cyano-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 99682372 |
| Molecular Formula | C35H27Br2Cl2NO4 |
| Molecular Weight | 756.32 g/mol |
| Exact Mass | 752.97 |
| IUPAC Name | ethyl (1S,2R,3R,4R,6S)-3-(4-bromobenzoyl)-4-(4-bromophenyl)-2,6-bis(4-chlorophenyl)-1-cyano-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)[C@H](c2ccc(Cl)cc2)C[C@](O)(c2ccc(Br)cc2)[C@H](C(=O)c2ccc(Br)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H27Br2Cl2NO4/c1-2-44-33(42)34(20-40)29(21-5-15-27(38)16-6-21)19-35(43,24-9-13-26(37)14-10-24)31(30(34)22-7-17-28(39)18-8-22)32(41)23-3-11-25(36)12-4-23/h3-18,29-31,43H,2,19H2,1H3/t29-,30-,31-,34-,35-/m0/s1 |
| InChIKey | MJIDTFLOMGOJSN-WXNYECDESA-N |
| XLogP | 9.25 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.32 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |