C35H30N2O2 — CID 26475608
(2S,3S,4S,6S)-3-benzoyl-4-hydroxy-2,6-bis(4-methylphenyl)-4-phenylcyclohexane-1,1-dicarbonitrile (PubChem CID 26475608) has the molecular formula C35H30N2O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is (2S,3S,4S,6S)-3-benzoyl-4-hydroxy-2,6-bis(4-methylphenyl)-4-phenylcyclohexane-1,1-dicarbonitrile.
| Compound Name | (2S,3S,4S,6S)-3-benzoyl-4-hydroxy-2,6-bis(4-methylphenyl)-4-phenylcyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 26475608 |
| Molecular Formula | C35H30N2O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (2S,3S,4S,6S)-3-benzoyl-4-hydroxy-2,6-bis(4-methylphenyl)-4-phenylcyclohexane-1,1-dicarbonitrile |
| SMILES | Cc1ccc([C@@H]2[C@H](C(=O)c3ccccc3)[C@](O)(c3ccccc3)C[C@@H](c3ccc(C)cc3)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C35H30N2O2/c1-24-13-17-26(18-14-24)30-21-35(39,29-11-7-4-8-12-29)32(33(38)28-9-5-3-6-10-28)31(34(30,22-36)23-37)27-19-15-25(2)16-20-27/h3-20,30-32,39H,21H2,1-2H3/t30-,31+,32+,35+/m0/s1 |
| InChIKey | WCIXCLURGHTUOE-TUHHXPBESA-N |
| XLogP | 6.99 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |