C36H32N2O4S — CID 57342385
9-hydroxy-10-(4-methylbenzoyl)-9-(4-methylphenyl)-7,11-diphenyl-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5-dione (PubChem CID 57342385) has the molecular formula C36H32N2O4S and a molecular weight of 588.73 g/mol. Its IUPAC name is 9-hydroxy-10-(4-methylbenzoyl)-9-(4-methylphenyl)-7,11-diphenyl-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5-dione.
| Compound Name | 9-hydroxy-10-(4-methylbenzoyl)-9-(4-methylphenyl)-7,11-diphenyl-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5-dione |
|---|---|
| PubChem CID | 57342385 |
| Molecular Formula | C36H32N2O4S |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 9-hydroxy-10-(4-methylbenzoyl)-9-(4-methylphenyl)-7,11-diphenyl-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5-dione |
| SMILES | Cc1ccc(C(=O)C2C(c3ccccc3)C3(C(=O)NC(=S)NC3=O)C(c3ccccc3)CC2(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H32N2O4S/c1-22-13-17-26(18-14-22)31(39)30-29(25-11-7-4-8-12-25)36(32(40)37-34(43)38-33(36)41)28(24-9-5-3-6-10-24)21-35(30,42)27-19-15-23(2)16-20-27/h3-20,28-30,42H,21H2,1-2H3,(H2,37,38,40,41,43) |
| InChIKey | PLDYSOZXSKUHNS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|