C23H22N2O6S2 — CID 24829194
methyl (7S,10R,11R)-11-(4-methylphenyl)-1,5,9,9-tetraoxo-7-phenyl-3-sulfanylidene-9λ6-thia-2,4-diazaspiro[5.5]undecane-10-carboxylate (PubChem CID 24829194) has the molecular formula C23H22N2O6S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is methyl (7S,10R,11R)-11-(4-methylphenyl)-1,5,9,9-tetraoxo-7-phenyl-3-sulfanylidene-9λ6-thia-2,4-diazaspiro[5.5]undecane-10-carboxylate.
| Compound Name | methyl (7S,10R,11R)-11-(4-methylphenyl)-1,5,9,9-tetraoxo-7-phenyl-3-sulfanylidene-9λ6-thia-2,4-diazaspiro[5.5]undecane-10-carboxylate |
|---|---|
| PubChem CID | 24829194 |
| Molecular Formula | C23H22N2O6S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | methyl (7S,10R,11R)-11-(4-methylphenyl)-1,5,9,9-tetraoxo-7-phenyl-3-sulfanylidene-9λ6-thia-2,4-diazaspiro[5.5]undecane-10-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccc(C)cc2)C2(C(=O)NC(=S)NC2=O)[C@H](c2ccccc2)CS1(=O)=O |
| InChI | InChI=1S/C23H22N2O6S2/c1-13-8-10-15(11-9-13)17-18(19(26)31-2)33(29,30)12-16(14-6-4-3-5-7-14)23(17)20(27)24-22(32)25-21(23)28/h3-11,16-18H,12H2,1-2H3,(H2,24,25,27,28,32)/t16-,17-,18+/m0/s1 |
| InChIKey | SMWHPCMHFOZNFL-OKZBNKHCSA-N |
| XLogP | 1.35 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|