C14H16O8S2 — CID 988542
dimethyl (4R,6R)-1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate (PubChem CID 988542) has the molecular formula C14H16O8S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is dimethyl (4R,6R)-1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate.
| Compound Name | dimethyl (4R,6R)-1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 988542 |
| Molecular Formula | C14H16O8S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | dimethyl (4R,6R)-1,1,3,3-tetraoxo-5-phenyl-1,3-dithiane-4,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(c2ccccc2)[C@H](C(=O)OC)S(=O)(=O)CS1(=O)=O |
| InChI | InChI=1S/C14H16O8S2/c1-21-13(15)11-10(9-6-4-3-5-7-9)12(14(16)22-2)24(19,20)8-23(11,17)18/h3-7,10-12H,8H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | LTCSYAOAYYRGCB-VXGBXAGGSA-N |
| XLogP | -0.35 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |