C33H24F2N2O2 — CID 139086712
(2S,3R,4S,6R)-3-(4-fluorobenzoyl)-4-(4-fluorophenyl)-4-hydroxy-2,6-diphenylcyclohexane-1,1-dicarbonitrile (PubChem CID 139086712) has the molecular formula C33H24F2N2O2 and a molecular weight of 518.56 g/mol. Its IUPAC name is (2S,3R,4S,6R)-3-(4-fluorobenzoyl)-4-(4-fluorophenyl)-4-hydroxy-2,6-diphenylcyclohexane-1,1-dicarbonitrile.
| Compound Name | (2S,3R,4S,6R)-3-(4-fluorobenzoyl)-4-(4-fluorophenyl)-4-hydroxy-2,6-diphenylcyclohexane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 139086712 |
| Molecular Formula | C33H24F2N2O2 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (2S,3R,4S,6R)-3-(4-fluorobenzoyl)-4-(4-fluorophenyl)-4-hydroxy-2,6-diphenylcyclohexane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](c2ccccc2)C[C@@](O)(c2ccc(F)cc2)[C@H](C(=O)c2ccc(F)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C33H24F2N2O2/c34-26-15-11-24(12-16-26)31(38)30-29(23-9-5-2-6-10-23)32(20-36,21-37)28(22-7-3-1-4-8-22)19-33(30,39)25-13-17-27(35)18-14-25/h1-18,28-30,39H,19H2/t28-,29-,30+,33-/m1/s1 |
| InChIKey | ZBGUMOKDEJRSRA-LFQASTLSSA-N |
| XLogP | 6.66 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |